C22H16ClF3N4O4S — CID 135495424
2-[[4-chloro-3-(trifluoromethyl)phenyl]diazenyl]-3-hydroxy-3-phenyl-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 135495424) has the molecular formula C22H16ClF3N4O4S and a molecular weight of 524.91 g/mol. Its IUPAC name is 2-[[4-chloro-3-(trifluoromethyl)phenyl]diazenyl]-3-hydroxy-3-phenyl-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]diazenyl]-3-hydroxy-3-phenyl-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 135495424 |
| Molecular Formula | C22H16ClF3N4O4S |
| Molecular Weight | 524.91 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]diazenyl]-3-hydroxy-3-phenyl-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(/N=N/c2ccc(Cl)c(C(F)(F)F)c2)=C(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16ClF3N4O4S/c23-18-11-8-15(12-17(18)22(24,25)26)29-30-19(20(31)13-4-2-1-3-5-13)21(32)28-14-6-9-16(10-7-14)35(27,33)34/h1-12,31H,(H,28,32)(H2,27,33,34)/b20-19?,30-29+ |
| InChIKey | AMMCQRSBSDHUQY-QPUWBDKYSA-N |
| XLogP | 5.66 |
| TPSA | 134.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.91 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|