C21H14ClF3N4O2 — CID 135517198
(E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]diazenyl]-3-hydroxy-3-phenyl-N-pyridin-3-ylprop-2-enamide (PubChem CID 135517198) has the molecular formula C21H14ClF3N4O2 and a molecular weight of 446.82 g/mol. Its IUPAC name is (E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]diazenyl]-3-hydroxy-3-phenyl-N-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]diazenyl]-3-hydroxy-3-phenyl-N-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 135517198 |
| Molecular Formula | C21H14ClF3N4O2 |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | (E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]diazenyl]-3-hydroxy-3-phenyl-N-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(Nc1cccnc1)C(/N=N/c1ccc(Cl)c(C(F)(F)F)c1)=C(\O)c1ccccc1 |
| InChI | InChI=1S/C21H14ClF3N4O2/c22-17-9-8-14(11-16(17)21(23,24)25)28-29-18(19(30)13-5-2-1-3-6-13)20(31)27-15-7-4-10-26-12-15/h1-12,30H,(H,27,31)/b19-18+,29-28+ |
| InChIKey | JACGINFOAOSMLZ-XYNJFPDTSA-N |
| XLogP | 6.40 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|