C27H20N6O2 — CID 135558018
(Z)-2-[[4-(1H-benzimidazol-2-yl)phenyl]diazenyl]-3-hydroxy-3-phenyl-N-pyridin-3-ylprop-2-enamide (PubChem CID 135558018) has the molecular formula C27H20N6O2 and a molecular weight of 460.50 g/mol. Its IUPAC name is (Z)-2-[[4-(1H-benzimidazol-2-yl)phenyl]diazenyl]-3-hydroxy-3-phenyl-N-pyridin-3-ylprop-2-enamide.
| Compound Name | (Z)-2-[[4-(1H-benzimidazol-2-yl)phenyl]diazenyl]-3-hydroxy-3-phenyl-N-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 135558018 |
| Molecular Formula | C27H20N6O2 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | (Z)-2-[[4-(1H-benzimidazol-2-yl)phenyl]diazenyl]-3-hydroxy-3-phenyl-N-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(Nc1cccnc1)C(/N=N/c1ccc(-c2nc3ccccc3[nH]2)cc1)=C(/O)c1ccccc1 |
| InChI | InChI=1S/C27H20N6O2/c34-25(18-7-2-1-3-8-18)24(27(35)29-21-9-6-16-28-17-21)33-32-20-14-12-19(13-15-20)26-30-22-10-4-5-11-23(22)31-26/h1-17,34H,(H,29,35)(H,30,31)/b25-24-,33-32+ |
| InChIKey | DDEYGMJYKBLQHA-OJFKOJBMSA-N |
| XLogP | 6.27 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|