C25H24N4O6S — CID 135676371
diethyl 5-[[(E)-1-hydroxy-3-oxo-1-phenyl-3-(pyridin-3-ylamino)prop-1-en-2-yl]diazenyl]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 135676371) has the molecular formula C25H24N4O6S and a molecular weight of 508.56 g/mol. Its IUPAC name is diethyl 5-[[(E)-1-hydroxy-3-oxo-1-phenyl-3-(pyridin-3-ylamino)prop-1-en-2-yl]diazenyl]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[(E)-1-hydroxy-3-oxo-1-phenyl-3-(pyridin-3-ylamino)prop-1-en-2-yl]diazenyl]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 135676371 |
| Molecular Formula | C25H24N4O6S |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | diethyl 5-[[(E)-1-hydroxy-3-oxo-1-phenyl-3-(pyridin-3-ylamino)prop-1-en-2-yl]diazenyl]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(/N=N/C(C(=O)Nc2cccnc2)=C(/O)c2ccccc2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C25H24N4O6S/c1-4-34-24(32)18-15(3)21(25(33)35-5-2)36-23(18)29-28-19(20(30)16-10-7-6-8-11-16)22(31)27-17-12-9-13-26-14-17/h6-14,30H,4-5H2,1-3H3,(H,27,31)/b20-19+,29-28+ |
| InChIKey | BLEZTHNHPXIQQH-HFMLVVDVSA-N |
| XLogP | 5.45 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|