C22H23N3O9S — CID 135475581
diethyl 5-[[(Z)-3-ethoxy-1-hydroxy-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]diazenyl]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 135475581) has the molecular formula C22H23N3O9S and a molecular weight of 505.51 g/mol. Its IUPAC name is diethyl 5-[[(Z)-3-ethoxy-1-hydroxy-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]diazenyl]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[(Z)-3-ethoxy-1-hydroxy-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]diazenyl]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 135475581 |
| Molecular Formula | C22H23N3O9S |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | diethyl 5-[[(Z)-3-ethoxy-1-hydroxy-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]diazenyl]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)C(/N=N/c1sc(C(=O)OCC)c(C)c1C(=O)OCC)=C(/O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H23N3O9S/c1-5-32-20(27)15-12(4)18(22(29)34-7-3)35-19(15)24-23-16(21(28)33-6-2)17(26)13-8-10-14(11-9-13)25(30)31/h8-11,26H,5-7H2,1-4H3/b17-16-,24-23+ |
| InChIKey | OZKQQZFPGCJTAJ-ZVZIIWFCSA-N |
| XLogP | 4.89 |
| TPSA | 166.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|