About copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate
copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 58773938) has the molecular formula C12H10CuN2O5
and a molecular weight of 325.77 g/mol. Its IUPAC name is copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate |
| PubChem CID | 58773938 |
| Molecular Formula | C12H10CuN2O5 |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | [C-]#[N+]/C(C(=O)OCC)=C(/O)c1ccc([N+](=O)[O-])cc1.[Cu] |
| InChI | InChI=1S/C12H10N2O5.Cu/c1-3-19-12(16)10(13-2)11(15)8-4-6-9(7-5-8)14(17)18;/h4-7,15H,3H2,1H3;/b11-10+; |
| InChIKey | XOHPUNTVWKXNBA-ASTDGNLGSA-N |
| XLogP | 2.30 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate?
The IUPAC name of copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate (CID 58773938) is copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate.
What is the SMILES notation for copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate?
The canonical SMILES for copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate is [C-]#[N+]/C(C(=O)OCC)=C(/O)c1ccc([N+](=O)[O-])cc1.[Cu].
What is the InChIKey of copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate?
The InChIKey is XOHPUNTVWKXNBA-ASTDGNLGSA-N. The full InChI is InChI=1S/C12H10N2O5.Cu/c1-3-19-12(16)10(13-2)11(15)8-4-6-9(7-5-8)14(17)18;/h4-7,15H,3H2,1H3;/b11-10+;.
What are the key properties of copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate?
copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate has a molecular weight of 325.77 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for copper;ethyl (E)-3-hydroxy-2-isocyano-3-(4-nitrophenyl)prop-2-enoate is sourced from PubChem (CID 58773938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).