C12H11CuNO7 — CID 169308979
copper;1,5-dihydroxy-3-[hydroxy-(4-nitrophenyl)methylidene]pentane-2,4-dione (PubChem CID 169308979) has the molecular formula C12H11CuNO7 and a molecular weight of 344.77 g/mol. Its IUPAC name is copper;1,5-dihydroxy-3-[hydroxy-(4-nitrophenyl)methylidene]pentane-2,4-dione.
| Compound Name | copper;1,5-dihydroxy-3-[hydroxy-(4-nitrophenyl)methylidene]pentane-2,4-dione |
|---|---|
| PubChem CID | 169308979 |
| Molecular Formula | C12H11CuNO7 |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | copper;1,5-dihydroxy-3-[hydroxy-(4-nitrophenyl)methylidene]pentane-2,4-dione |
| SMILES | O=C(CO)C(C(=O)CO)=C(O)c1ccc([N+](=O)[O-])cc1.[Cu] |
| InChI | InChI=1S/C12H11NO7.Cu/c14-5-9(16)11(10(17)6-15)12(18)7-1-3-8(4-2-7)13(19)20;/h1-4,14-15,18H,5-6H2; |
| InChIKey | RLYPUMKEVSBFPE-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|