C21H23N3O6S — CID 135461351
diethyl 5-[[(E)-1-anilino-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 135461351) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is diethyl 5-[[(E)-1-anilino-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[(E)-1-anilino-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 135461351 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | diethyl 5-[[(E)-1-anilino-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(/N=N/C(C(=O)Nc2ccccc2)=C(\C)O)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C21H23N3O6S/c1-5-29-20(27)15-12(3)17(21(28)30-6-2)31-19(15)24-23-16(13(4)25)18(26)22-14-10-8-7-9-11-14/h7-11,25H,5-6H2,1-4H3,(H,22,26)/b16-13+,24-23+ |
| InChIKey | CPPMGTUTWUVOJA-ZIHNWASFSA-N |
| XLogP | 4.92 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|