C17H17N5O6S — CID 135499021
ethyl 2-[[3-hydroxy-2-[(3-nitrophenyl)diazenyl]but-2-enoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 135499021) has the molecular formula C17H17N5O6S and a molecular weight of 419.42 g/mol. Its IUPAC name is ethyl 2-[[3-hydroxy-2-[(3-nitrophenyl)diazenyl]but-2-enoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[3-hydroxy-2-[(3-nitrophenyl)diazenyl]but-2-enoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 135499021 |
| Molecular Formula | C17H17N5O6S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | ethyl 2-[[3-hydroxy-2-[(3-nitrophenyl)diazenyl]but-2-enoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)C(/N=N/c2cccc([N+](=O)[O-])c2)=C(C)O)nc1C |
| InChI | InChI=1S/C17H17N5O6S/c1-4-28-16(25)14-9(2)18-17(29-14)19-15(24)13(10(3)23)21-20-11-6-5-7-12(8-11)22(26)27/h5-8,23H,4H2,1-3H3,(H,18,19,24)/b13-10?,21-20+ |
| InChIKey | OUYVIWFZHZFQRD-APUROVLGSA-N |
| XLogP | 4.05 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|