C18H17FN4O6S — CID 164773440
2-[[(E)-1-[(5-ethoxycarbonyl-4-methyl-1,3-thiazol-2-yl)amino]-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]-4-fluorobenzoic acid (PubChem CID 164773440) has the molecular formula C18H17FN4O6S and a molecular weight of 436.42 g/mol. Its IUPAC name is 2-[[(E)-1-[(5-ethoxycarbonyl-4-methyl-1,3-thiazol-2-yl)amino]-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]-4-fluorobenzoic acid.
| Compound Name | 2-[[(E)-1-[(5-ethoxycarbonyl-4-methyl-1,3-thiazol-2-yl)amino]-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 164773440 |
| Molecular Formula | C18H17FN4O6S |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-[[(E)-1-[(5-ethoxycarbonyl-4-methyl-1,3-thiazol-2-yl)amino]-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]-4-fluorobenzoic acid |
| SMILES | CCOC(=O)c1sc(NC(=O)C(/N=N/c2cc(F)ccc2C(=O)O)=C(/C)O)nc1C |
| InChI | InChI=1S/C18H17FN4O6S/c1-4-29-17(28)14-8(2)20-18(30-14)21-15(25)13(9(3)24)23-22-12-7-10(19)5-6-11(12)16(26)27/h5-7,24H,4H2,1-3H3,(H,26,27)(H,20,21,25)/b13-9+,23-22+ |
| InChIKey | XYWNFCHMKVLMIX-QQZHPOJYSA-N |
| XLogP | 3.98 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|