C18H20N5O4+ — CID 136864612
ethyl 4-[[1-[(1-aminopyridin-1-ium-3-yl)amino]-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]benzoate (PubChem CID 136864612) has the molecular formula C18H20N5O4+ and a molecular weight of 370.39 g/mol. Its IUPAC name is ethyl 4-[[1-[(1-aminopyridin-1-ium-3-yl)amino]-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]benzoate.
| Compound Name | ethyl 4-[[1-[(1-aminopyridin-1-ium-3-yl)amino]-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 136864612 |
| Molecular Formula | C18H20N5O4+ |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | ethyl 4-[[1-[(1-aminopyridin-1-ium-3-yl)amino]-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/C(C(=O)Nc2ccc[n+](N)c2)=C(C)O)cc1 |
| InChI | InChI=1S/C18H19N5O4/c1-3-27-18(26)13-6-8-14(9-7-13)21-22-16(12(2)24)17(25)20-15-5-4-10-23(19)11-15/h4-11H,3,19H2,1-2H3,(H-,20,21,24,25,26)/p+1 |
| InChIKey | RUWKGEBOIVJZNJ-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|