C14H18N2O4 — CID 135459171
ethyl 2-[(4-ethoxyphenyl)diazenyl]-3-hydroxybut-2-enoate (PubChem CID 135459171) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is ethyl 2-[(4-ethoxyphenyl)diazenyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl 2-[(4-ethoxyphenyl)diazenyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135459171 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | ethyl 2-[(4-ethoxyphenyl)diazenyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccc(OCC)cc1)=C(C)O |
| InChI | InChI=1S/C14H18N2O4/c1-4-19-12-8-6-11(7-9-12)15-16-13(10(3)17)14(18)20-5-2/h6-9,17H,4-5H2,1-3H3/b13-10?,16-15+ |
| InChIKey | JGTCKRVLHMVIFK-PJRMFTMZSA-N |
| XLogP | 3.52 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|