C14H14N4O4S — CID 135493479
ethyl (Z)-3-hydroxy-2-[[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]diazenyl]but-2-enoate (PubChem CID 135493479) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is ethyl (Z)-3-hydroxy-2-[[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]diazenyl]but-2-enoate.
| Compound Name | ethyl (Z)-3-hydroxy-2-[[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]diazenyl]but-2-enoate |
|---|---|
| PubChem CID | 135493479 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | ethyl (Z)-3-hydroxy-2-[[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]diazenyl]but-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccc(-c2n[nH]c(=S)o2)cc1)=C(\C)O |
| InChI | InChI=1S/C14H14N4O4S/c1-3-21-13(20)11(8(2)19)16-15-10-6-4-9(5-7-10)12-17-18-14(23)22-12/h4-7,19H,3H2,1-2H3,(H,18,23)/b11-8-,16-15+ |
| InChIKey | JCDWQEGQUWGHMQ-BEVTXSIGSA-N |
| XLogP | 3.84 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|