C27H32N4O8 — CID 135424015
ethyl (Z)-2-[[4-[3-[4-[[(Z)-1-ethoxy-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]phenoxy]propoxy]phenyl]diazenyl]-3-hydroxybut-2-enoate (PubChem CID 135424015) has the molecular formula C27H32N4O8 and a molecular weight of 540.57 g/mol. Its IUPAC name is ethyl (Z)-2-[[4-[3-[4-[[(Z)-1-ethoxy-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]phenoxy]propoxy]phenyl]diazenyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl (Z)-2-[[4-[3-[4-[[(Z)-1-ethoxy-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]phenoxy]propoxy]phenyl]diazenyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135424015 |
| Molecular Formula | C27H32N4O8 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | ethyl (Z)-2-[[4-[3-[4-[[(Z)-1-ethoxy-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]phenoxy]propoxy]phenyl]diazenyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccc(OCCCOc2ccc(/N=N/C(C(=O)OCC)=C(/C)O)cc2)cc1)=C(\C)O |
| InChI | InChI=1S/C27H32N4O8/c1-5-36-26(34)24(18(3)32)30-28-20-8-12-22(13-9-20)38-16-7-17-39-23-14-10-21(11-15-23)29-31-25(19(4)33)27(35)37-6-2/h8-15,32-33H,5-7,16-17H2,1-4H3/b24-18-,25-19-,30-28+,31-29+ |
| InChIKey | NITOZPHBTXEGRI-BVMUJKNHSA-N |
| XLogP | 6.41 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|