C31H29N2O4P — CID 135402311
ethyl 3-hydroxy-2-[(4-methoxyphenyl)diazenyl]-4-(triphenyl-λ5-phosphanylidene)but-2-enoate (PubChem CID 135402311) has the molecular formula C31H29N2O4P and a molecular weight of 524.56 g/mol. Its IUPAC name is ethyl 3-hydroxy-2-[(4-methoxyphenyl)diazenyl]-4-(triphenyl-λ5-phosphanylidene)but-2-enoate.
| Compound Name | ethyl 3-hydroxy-2-[(4-methoxyphenyl)diazenyl]-4-(triphenyl-λ5-phosphanylidene)but-2-enoate |
|---|---|
| PubChem CID | 135402311 |
| Molecular Formula | C31H29N2O4P |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | ethyl 3-hydroxy-2-[(4-methoxyphenyl)diazenyl]-4-(triphenyl-λ5-phosphanylidene)but-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccc(OC)cc1)=C(O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H29N2O4P/c1-3-37-31(35)30(33-32-24-19-21-25(36-2)22-20-24)29(34)23-38(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-23,34H,3H2,1-2H3/b30-29?,33-32+ |
| InChIKey | LWKJXJSPYJVILV-ISBUUUTHSA-N |
| XLogP | 5.91 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|