C16H15N3O3 — CID 157218994
3-hydroxy-2-[(4-hydroxyphenyl)diazenyl]-N-phenylbut-2-enamide (PubChem CID 157218994) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-hydroxy-2-[(4-hydroxyphenyl)diazenyl]-N-phenylbut-2-enamide.
| Compound Name | 3-hydroxy-2-[(4-hydroxyphenyl)diazenyl]-N-phenylbut-2-enamide |
|---|---|
| PubChem CID | 157218994 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-hydroxy-2-[(4-hydroxyphenyl)diazenyl]-N-phenylbut-2-enamide |
| SMILES | CC(O)=C(/N=N/c1ccc(O)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H15N3O3/c1-11(20)15(16(22)17-12-5-3-2-4-6-12)19-18-13-7-9-14(21)10-8-13/h2-10,20-21H,1H3,(H,17,22)/b15-11?,19-18+ |
| InChIKey | PCKYOWXSYGQPGT-DCKMHALMSA-N |
| XLogP | 3.90 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|