C11H12ClN3O2 — CID 137179746
(E)-2-[(4-chlorophenyl)diazenyl]-3-hydroxy-N-methylbut-2-enamide (PubChem CID 137179746) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is (E)-2-[(4-chlorophenyl)diazenyl]-3-hydroxy-N-methylbut-2-enamide.
| Compound Name | (E)-2-[(4-chlorophenyl)diazenyl]-3-hydroxy-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 137179746 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | (E)-2-[(4-chlorophenyl)diazenyl]-3-hydroxy-N-methylbut-2-enamide |
| SMILES | CNC(=O)C(/N=N/c1ccc(Cl)cc1)=C(/C)O |
| InChI | InChI=1S/C11H12ClN3O2/c1-7(16)10(11(17)13-2)15-14-9-5-3-8(12)4-6-9/h3-6,16H,1-2H3,(H,13,17)/b10-7+,15-14+ |
| InChIKey | HXPNORBRHNJKIQ-YFLNMOBYSA-N |
| XLogP | 2.96 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|