C11H11Cl2N3O2 — CID 135599740
(Z)-2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxy-N-methylbut-2-enamide (PubChem CID 135599740) has the molecular formula C11H11Cl2N3O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is (Z)-2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxy-N-methylbut-2-enamide.
| Compound Name | (Z)-2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxy-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 135599740 |
| Molecular Formula | C11H11Cl2N3O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | (Z)-2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxy-N-methylbut-2-enamide |
| SMILES | CNC(=O)C(/N=N/c1ccc(Cl)c(Cl)c1)=C(\C)O |
| InChI | InChI=1S/C11H11Cl2N3O2/c1-6(17)10(11(18)14-2)16-15-7-3-4-8(12)9(13)5-7/h3-5,17H,1-2H3,(H,14,18)/b10-6-,16-15+ |
| InChIKey | ZUWBTCAIMWTRRG-WXNHPGFZSA-N |
| XLogP | 3.61 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|