About 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine
1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine (PubChem CID 88839912) has the molecular formula C9H10Cl2N2O
and a molecular weight of 233.10 g/mol. Its IUPAC name is 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine.
Molecular Properties
| Compound Name | 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine |
| PubChem CID | 88839912 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine |
| SMILES | CNC.O=C=Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H3Cl2NO.C2H7N/c8-6-2-1-5(10-4-11)3-7(6)9;1-3-2/h1-3H;3H,1-2H3 |
| InChIKey | FKWICINTIPOMRY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine?
The IUPAC name of 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine (CID 88839912) is 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine.
What is the SMILES notation for 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine?
The canonical SMILES for 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine is CNC.O=C=Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine?
The InChIKey is FKWICINTIPOMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2NO.C2H7N/c8-6-2-1-5(10-4-11)3-7(6)9;1-3-2/h1-3H;3H,1-2H3.
What are the key properties of 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine?
1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine has a molecular weight of 233.10 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-4-isocyanatobenzene;N-methylmethanamine is sourced from PubChem (CID 88839912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).