C13H9Cl2F3N2O2 — CID 137279087
(Z)-1-cyclopropyl-2-[(3,4-dichlorophenyl)diazenyl]-4,4,4-trifluoro-3-hydroxybut-2-en-1-one (PubChem CID 137279087) has the molecular formula C13H9Cl2F3N2O2 and a molecular weight of 353.13 g/mol. Its IUPAC name is (Z)-1-cyclopropyl-2-[(3,4-dichlorophenyl)diazenyl]-4,4,4-trifluoro-3-hydroxybut-2-en-1-one.
| Compound Name | (Z)-1-cyclopropyl-2-[(3,4-dichlorophenyl)diazenyl]-4,4,4-trifluoro-3-hydroxybut-2-en-1-one |
|---|---|
| PubChem CID | 137279087 |
| Molecular Formula | C13H9Cl2F3N2O2 |
| Molecular Weight | 353.13 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | (Z)-1-cyclopropyl-2-[(3,4-dichlorophenyl)diazenyl]-4,4,4-trifluoro-3-hydroxybut-2-en-1-one |
| SMILES | O=C(C(/N=N/c1ccc(Cl)c(Cl)c1)=C(/O)C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C13H9Cl2F3N2O2/c14-8-4-3-7(5-9(8)15)19-20-10(11(21)6-1-2-6)12(22)13(16,17)18/h3-6,22H,1-2H2/b12-10-,20-19+ |
| InChIKey | BGQNZDYVZUZHHM-GDALJVOYSA-N |
| XLogP | 5.39 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.13 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|