C12H9Cl2N3O — CID 2818912
2-cyclopropyl-N-(3,4-dichloroanilino)-2-oxoethanimidoyl cyanide (PubChem CID 2818912) has the molecular formula C12H9Cl2N3O and a molecular weight of 282.13 g/mol. Its IUPAC name is 2-cyclopropyl-N-(3,4-dichloroanilino)-2-oxoethanimidoyl cyanide.
| Compound Name | 2-cyclopropyl-N-(3,4-dichloroanilino)-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 2818912 |
| Molecular Formula | C12H9Cl2N3O |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 2-cyclopropyl-N-(3,4-dichloroanilino)-2-oxoethanimidoyl cyanide |
| SMILES | N#CC(=NNc1ccc(Cl)c(Cl)c1)C(=O)C1CC1 |
| InChI | InChI=1S/C12H9Cl2N3O/c13-9-4-3-8(5-10(9)14)16-17-11(6-15)12(18)7-1-2-7/h3-5,7,16H,1-2H2 |
| InChIKey | TWIPWLJATQLORT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|