C10H8Cl2O — CID 19806646
cyclopropyl-(3,4-dichlorophenyl)methanone (PubChem CID 19806646) has the molecular formula C10H8Cl2O and a molecular weight of 215.08 g/mol. Its IUPAC name is cyclopropyl-(3,4-dichlorophenyl)methanone.
| Compound Name | cyclopropyl-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 19806646 |
| Molecular Formula | C10H8Cl2O |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | cyclopropyl-(3,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)C1CC1 |
| InChI | InChI=1S/C10H8Cl2O/c11-8-4-3-7(5-9(8)12)10(13)6-1-2-6/h3-6H,1-2H2 |
| InChIKey | KDVARTRUFLNVCP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |