C11H10Cl2O — CID 24724150
cyclobutyl-(3,4-dichlorophenyl)methanone (PubChem CID 24724150) has the molecular formula C11H10Cl2O and a molecular weight of 229.11 g/mol. Its IUPAC name is cyclobutyl-(3,4-dichlorophenyl)methanone.
| Compound Name | cyclobutyl-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 24724150 |
| Molecular Formula | C11H10Cl2O |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | cyclobutyl-(3,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)C1CCC1 |
| InChI | InChI=1S/C11H10Cl2O/c12-9-5-4-8(6-10(9)13)11(14)7-2-1-3-7/h4-7H,1-3H2 |
| InChIKey | IWXVLJAVZHYAAF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |