C26H28Cl2N2O3 — CID 55955366
N-[3-[4-(3,4-dichlorobenzoyl)piperidine-1-carbonyl]phenyl]cyclohexanecarboxamide (PubChem CID 55955366) has the molecular formula C26H28Cl2N2O3 and a molecular weight of 487.43 g/mol. Its IUPAC name is N-[3-[4-(3,4-dichlorobenzoyl)piperidine-1-carbonyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[4-(3,4-dichlorobenzoyl)piperidine-1-carbonyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 55955366 |
| Molecular Formula | C26H28Cl2N2O3 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-[3-[4-(3,4-dichlorobenzoyl)piperidine-1-carbonyl]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCC(C(=O)c3ccc(Cl)c(Cl)c3)CC2)c1)C1CCCCC1 |
| InChI | InChI=1S/C26H28Cl2N2O3/c27-22-10-9-19(16-23(22)28)24(31)17-11-13-30(14-12-17)26(33)20-7-4-8-21(15-20)29-25(32)18-5-2-1-3-6-18/h4,7-10,15-18H,1-3,5-6,11-14H2,(H,29,32) |
| InChIKey | PHBQTRWCSXXTJK-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |