C14H16Cl2O — CID 63490974
cycloheptyl-(3,4-dichlorophenyl)methanone (PubChem CID 63490974) has the molecular formula C14H16Cl2O and a molecular weight of 271.19 g/mol. Its IUPAC name is cycloheptyl-(3,4-dichlorophenyl)methanone.
| Compound Name | cycloheptyl-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 63490974 |
| Molecular Formula | C14H16Cl2O |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | cycloheptyl-(3,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)C1CCCCCC1 |
| InChI | InChI=1S/C14H16Cl2O/c15-12-8-7-11(9-13(12)16)14(17)10-5-3-1-2-4-6-10/h7-10H,1-6H2 |
| InChIKey | SWLCYAAQKICFER-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |