C16H13ClN2O6S — CID 148550264
4-[[1-(4-chlorophenyl)-1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl]diazenyl]benzenesulfonic acid (PubChem CID 148550264) has the molecular formula C16H13ClN2O6S and a molecular weight of 396.81 g/mol. Its IUPAC name is 4-[[1-(4-chlorophenyl)-1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[1-(4-chlorophenyl)-1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 148550264 |
| Molecular Formula | C16H13ClN2O6S |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 4-[[1-(4-chlorophenyl)-1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl]diazenyl]benzenesulfonic acid |
| SMILES | COC(=O)C(/N=N/c1ccc(S(=O)(=O)O)cc1)=C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClN2O6S/c1-25-16(21)14(15(20)10-2-4-11(17)5-3-10)19-18-12-6-8-13(9-7-12)26(22,23)24/h2-9,20H,1H3,(H,22,23,24)/b15-14?,19-18+ |
| InChIKey | GEJKLVWQYPTIEL-RZXRJBBISA-N |
| XLogP | 3.77 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|