C16H14N4O5 — CID 135941732
(Z)-3-hydroxy-2-[(2-hydroxy-4-nitrophenyl)diazenyl]-N-phenylbut-2-enamide (PubChem CID 135941732) has the molecular formula C16H14N4O5 and a molecular weight of 342.31 g/mol. Its IUPAC name is (Z)-3-hydroxy-2-[(2-hydroxy-4-nitrophenyl)diazenyl]-N-phenylbut-2-enamide.
| Compound Name | (Z)-3-hydroxy-2-[(2-hydroxy-4-nitrophenyl)diazenyl]-N-phenylbut-2-enamide |
|---|---|
| PubChem CID | 135941732 |
| Molecular Formula | C16H14N4O5 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (Z)-3-hydroxy-2-[(2-hydroxy-4-nitrophenyl)diazenyl]-N-phenylbut-2-enamide |
| SMILES | C/C(O)=C(/N=N/c1ccc([N+](=O)[O-])cc1O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H14N4O5/c1-10(21)15(16(23)17-11-5-3-2-4-6-11)19-18-13-8-7-12(20(24)25)9-14(13)22/h2-9,21-22H,1H3,(H,17,23)/b15-10-,19-18+ |
| InChIKey | YCVUMAWDCGSWGX-PXJVAEEZSA-N |
| XLogP | 3.81 |
| TPSA | 137.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|