C23H20N6O7S — CID 154008052
3-[[3-hydroxy-1-(3-nitroanilino)-1-oxobut-2-en-2-yl]diazenyl]-N-(3-sulfamoylphenyl)benzamide (PubChem CID 154008052) has the molecular formula C23H20N6O7S and a molecular weight of 524.52 g/mol. Its IUPAC name is 3-[[3-hydroxy-1-(3-nitroanilino)-1-oxobut-2-en-2-yl]diazenyl]-N-(3-sulfamoylphenyl)benzamide.
| Compound Name | 3-[[3-hydroxy-1-(3-nitroanilino)-1-oxobut-2-en-2-yl]diazenyl]-N-(3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 154008052 |
| Molecular Formula | C23H20N6O7S |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 3-[[3-hydroxy-1-(3-nitroanilino)-1-oxobut-2-en-2-yl]diazenyl]-N-(3-sulfamoylphenyl)benzamide |
| SMILES | CC(O)=C(/N=N/c1cccc(C(=O)Nc2cccc(S(N)(=O)=O)c2)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20N6O7S/c1-14(30)21(23(32)26-16-6-3-9-19(12-16)29(33)34)28-27-18-8-2-5-15(11-18)22(31)25-17-7-4-10-20(13-17)37(24,35)36/h2-13,30H,1H3,(H,25,31)(H,26,32)(H2,24,35,36)/b21-14?,28-27+ |
| InChIKey | BXHIYFOEHYZOBA-CWZOPYKCSA-N |
| XLogP | 4.01 |
| TPSA | 206.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|