C11H10N4O5S — CID 60692132
4-nitro-N-(3-sulfamoylphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 60692132) has the molecular formula C11H10N4O5S and a molecular weight of 310.29 g/mol. Its IUPAC name is 4-nitro-N-(3-sulfamoylphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-nitro-N-(3-sulfamoylphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60692132 |
| Molecular Formula | C11H10N4O5S |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 4-nitro-N-(3-sulfamoylphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2cc([N+](=O)[O-])c[nH]2)c1 |
| InChI | InChI=1S/C11H10N4O5S/c12-21(19,20)9-3-1-2-7(4-9)14-11(16)10-5-8(6-13-10)15(17)18/h1-6,13H,(H,14,16)(H2,12,19,20) |
| InChIKey | WBDZMOWHPKOLGL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 148.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|