C13H12N2O5S — CID 107722283
2,5-dihydroxy-N-(3-sulfamoylphenyl)benzamide (PubChem CID 107722283) has the molecular formula C13H12N2O5S and a molecular weight of 308.32 g/mol. Its IUPAC name is 2,5-dihydroxy-N-(3-sulfamoylphenyl)benzamide.
| Compound Name | 2,5-dihydroxy-N-(3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 107722283 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2,5-dihydroxy-N-(3-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2cc(O)ccc2O)c1 |
| InChI | InChI=1S/C13H12N2O5S/c14-21(19,20)10-3-1-2-8(6-10)15-13(18)11-7-9(16)4-5-12(11)17/h1-7,16-17H,(H,15,18)(H2,14,19,20) |
| InChIKey | SLWDWOBPTDPLRO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|