C11H10N2O3S2 — CID 60656415
N-(3-sulfamoylphenyl)thiophene-3-carboxamide (PubChem CID 60656415) has the molecular formula C11H10N2O3S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is N-(3-sulfamoylphenyl)thiophene-3-carboxamide.
| Compound Name | N-(3-sulfamoylphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 60656415 |
| Molecular Formula | C11H10N2O3S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | N-(3-sulfamoylphenyl)thiophene-3-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2ccsc2)c1 |
| InChI | InChI=1S/C11H10N2O3S2/c12-18(15,16)10-3-1-2-9(6-10)13-11(14)8-4-5-17-7-8/h1-7H,(H,13,14)(H2,12,15,16) |
| InChIKey | DNWNCKPETOWLTJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |