C11H11N3O3S2 — CID 60728385
N-[3-(sulfamoylamino)phenyl]thiophene-3-carboxamide (PubChem CID 60728385) has the molecular formula C11H11N3O3S2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[3-(sulfamoylamino)phenyl]thiophene-3-carboxamide.
| Compound Name | N-[3-(sulfamoylamino)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 60728385 |
| Molecular Formula | C11H11N3O3S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | N-[3-(sulfamoylamino)phenyl]thiophene-3-carboxamide |
| SMILES | NS(=O)(=O)Nc1cccc(NC(=O)c2ccsc2)c1 |
| InChI | InChI=1S/C11H11N3O3S2/c12-19(16,17)14-10-3-1-2-9(6-10)13-11(15)8-4-5-18-7-8/h1-7,14H,(H,13,15)(H2,12,16,17) |
| InChIKey | QONBBAIDSYSWGW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |