C8H12N4O5S — CID 61131829
4-nitro-N-(3-sulfamoylpropyl)-1H-pyrrole-2-carboxamide (PubChem CID 61131829) has the molecular formula C8H12N4O5S and a molecular weight of 276.27 g/mol. Its IUPAC name is 4-nitro-N-(3-sulfamoylpropyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-nitro-N-(3-sulfamoylpropyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61131829 |
| Molecular Formula | C8H12N4O5S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 4-nitro-N-(3-sulfamoylpropyl)-1H-pyrrole-2-carboxamide |
| SMILES | NS(=O)(=O)CCCNC(=O)c1cc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C8H12N4O5S/c9-18(16,17)3-1-2-10-8(13)7-4-6(5-11-7)12(14)15/h4-5,11H,1-3H2,(H,10,13)(H2,9,16,17) |
| InChIKey | HNXOSJACRBLXKZ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 148.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|