C7H12N4O4S — CID 61131501
2-oxo-N-(3-sulfamoylpropyl)-1,3-dihydroimidazole-4-carboxamide (PubChem CID 61131501) has the molecular formula C7H12N4O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-oxo-N-(3-sulfamoylpropyl)-1,3-dihydroimidazole-4-carboxamide.
| Compound Name | 2-oxo-N-(3-sulfamoylpropyl)-1,3-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 61131501 |
| Molecular Formula | C7H12N4O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-oxo-N-(3-sulfamoylpropyl)-1,3-dihydroimidazole-4-carboxamide |
| SMILES | NS(=O)(=O)CCCNC(=O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C7H12N4O4S/c8-16(14,15)3-1-2-9-6(12)5-4-10-7(13)11-5/h4H,1-3H2,(H,9,12)(H2,8,14,15)(H2,10,11,13) |
| InChIKey | DDDOQZRSAGZUOT-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|