C8H11N3O4S — CID 107261803
6-oxo-N-(2-sulfamoylethyl)-1H-pyridine-2-carboxamide (PubChem CID 107261803) has the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. Its IUPAC name is 6-oxo-N-(2-sulfamoylethyl)-1H-pyridine-2-carboxamide.
| Compound Name | 6-oxo-N-(2-sulfamoylethyl)-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107261803 |
| Molecular Formula | C8H11N3O4S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 6-oxo-N-(2-sulfamoylethyl)-1H-pyridine-2-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1cccc(=O)[nH]1 |
| InChI | InChI=1S/C8H11N3O4S/c9-16(14,15)5-4-10-8(13)6-2-1-3-7(12)11-6/h1-3H,4-5H2,(H,10,13)(H,11,12)(H2,9,14,15) |
| InChIKey | UOQVGNJALOMJNP-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |