C7H9Cl2N3O3S — CID 61131054
4,5-dichloro-N-(2-sulfamoylethyl)-1H-pyrrole-2-carboxamide (PubChem CID 61131054) has the molecular formula C7H9Cl2N3O3S and a molecular weight of 286.14 g/mol. Its IUPAC name is 4,5-dichloro-N-(2-sulfamoylethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-dichloro-N-(2-sulfamoylethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61131054 |
| Molecular Formula | C7H9Cl2N3O3S |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 4,5-dichloro-N-(2-sulfamoylethyl)-1H-pyrrole-2-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C7H9Cl2N3O3S/c8-4-3-5(12-6(4)9)7(13)11-1-2-16(10,14)15/h3,12H,1-2H2,(H,11,13)(H2,10,14,15) |
| InChIKey | ZVHSSSNYIOQGQS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |