C11H17Cl2N3O — CID 81484379
N-(2-amino-2-ethylbutyl)-4,5-dichloro-1H-pyrrole-2-carboxamide (PubChem CID 81484379) has the molecular formula C11H17Cl2N3O and a molecular weight of 278.18 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-4,5-dichloro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-4,5-dichloro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 81484379 |
| Molecular Formula | C11H17Cl2N3O |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-4,5-dichloro-1H-pyrrole-2-carboxamide |
| SMILES | CCC(N)(CC)CNC(=O)c1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C11H17Cl2N3O/c1-3-11(14,4-2)6-15-10(17)8-5-7(12)9(13)16-8/h5,16H,3-4,6,14H2,1-2H3,(H,15,17) |
| InChIKey | ZLEPHXPAWLHERT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |