C12H20ClN3O — CID 81484909
N-(2-amino-2-ethylbutyl)-4-chloro-1-methylpyrrole-2-carboxamide (PubChem CID 81484909) has the molecular formula C12H20ClN3O and a molecular weight of 257.76 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-4-chloro-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-4-chloro-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 81484909 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-4-chloro-1-methylpyrrole-2-carboxamide |
| SMILES | CCC(N)(CC)CNC(=O)c1cc(Cl)cn1C |
| InChI | InChI=1S/C12H20ClN3O/c1-4-12(14,5-2)8-15-11(17)10-6-9(13)7-16(10)3/h6-7H,4-5,8,14H2,1-3H3,(H,15,17) |
| InChIKey | JWJODTLRYGNLAS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |