C10H15ClN2O2 — CID 43500997
4-chloro-N-(1-hydroxy-2-methylpropan-2-yl)-1-methylpyrrole-2-carboxamide (PubChem CID 43500997) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. Its IUPAC name is 4-chloro-N-(1-hydroxy-2-methylpropan-2-yl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-(1-hydroxy-2-methylpropan-2-yl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43500997 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 4-chloro-N-(1-hydroxy-2-methylpropan-2-yl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Cl)cc1C(=O)NC(C)(C)CO |
| InChI | InChI=1S/C10H15ClN2O2/c1-10(2,6-14)12-9(15)8-4-7(11)5-13(8)3/h4-5,14H,6H2,1-3H3,(H,12,15) |
| InChIKey | LNDRTGQXEZDPJO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |