C12H19ClN2O2 — CID 64557195
4-chloro-1-ethyl-N-(1-hydroxy-2-methylbutan-2-yl)pyrrole-2-carboxamide (PubChem CID 64557195) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 4-chloro-1-ethyl-N-(1-hydroxy-2-methylbutan-2-yl)pyrrole-2-carboxamide.
| Compound Name | 4-chloro-1-ethyl-N-(1-hydroxy-2-methylbutan-2-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 64557195 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 4-chloro-1-ethyl-N-(1-hydroxy-2-methylbutan-2-yl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(Cl)cc1C(=O)NC(C)(CC)CO |
| InChI | InChI=1S/C12H19ClN2O2/c1-4-12(3,8-16)14-11(17)10-6-9(13)7-15(10)5-2/h6-7,16H,4-5,8H2,1-3H3,(H,14,17) |
| InChIKey | LRSJSFRPOVCKSI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |