C13H22ClN3O2 — CID 106143135
4-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-ethylpyrrole-2-carboxamide (PubChem CID 106143135) has the molecular formula C13H22ClN3O2 and a molecular weight of 287.79 g/mol. Its IUPAC name is 4-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-ethylpyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106143135 |
| Molecular Formula | C13H22ClN3O2 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Cl)cc1C(=O)NCC(C)(O)CN(C)C |
| InChI | InChI=1S/C13H22ClN3O2/c1-5-17-7-10(14)6-11(17)12(18)15-8-13(2,19)9-16(3)4/h6-7,19H,5,8-9H2,1-4H3,(H,15,18) |
| InChIKey | CJCYYIOZDZHSIE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |