C14H23ClN2O3 — CID 106250582
4-chloro-N-(2-hydroxy-4-methoxy-2-methylbutyl)-1-propylpyrrole-2-carboxamide (PubChem CID 106250582) has the molecular formula C14H23ClN2O3 and a molecular weight of 302.80 g/mol. Its IUPAC name is 4-chloro-N-(2-hydroxy-4-methoxy-2-methylbutyl)-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-(2-hydroxy-4-methoxy-2-methylbutyl)-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106250582 |
| Molecular Formula | C14H23ClN2O3 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-chloro-N-(2-hydroxy-4-methoxy-2-methylbutyl)-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Cl)cc1C(=O)NCC(C)(O)CCOC |
| InChI | InChI=1S/C14H23ClN2O3/c1-4-6-17-9-11(15)8-12(17)13(18)16-10-14(2,19)5-7-20-3/h8-9,19H,4-7,10H2,1-3H3,(H,16,18) |
| InChIKey | ODFIFPDICUHEJS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |