C13H21ClN2O2 — CID 79381001
4-chloro-N-(2-hydroxy-2-methylpropyl)-N-methyl-1-propylpyrrole-2-carboxamide (PubChem CID 79381001) has the molecular formula C13H21ClN2O2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 4-chloro-N-(2-hydroxy-2-methylpropyl)-N-methyl-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-(2-hydroxy-2-methylpropyl)-N-methyl-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 79381001 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-chloro-N-(2-hydroxy-2-methylpropyl)-N-methyl-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Cl)cc1C(=O)N(C)CC(C)(C)O |
| InChI | InChI=1S/C13H21ClN2O2/c1-5-6-16-8-10(14)7-11(16)12(17)15(4)9-13(2,3)18/h7-8,18H,5-6,9H2,1-4H3 |
| InChIKey | KJFZVPLUNDVVNL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |