C16H18BrClN2O — CID 60959903
4-bromo-N-[(4-chlorophenyl)methyl]-N-methyl-1-propylpyrrole-2-carboxamide (PubChem CID 60959903) has the molecular formula C16H18BrClN2O and a molecular weight of 369.69 g/mol. Its IUPAC name is 4-bromo-N-[(4-chlorophenyl)methyl]-N-methyl-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(4-chlorophenyl)methyl]-N-methyl-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60959903 |
| Molecular Formula | C16H18BrClN2O |
| Molecular Weight | 369.69 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 4-bromo-N-[(4-chlorophenyl)methyl]-N-methyl-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Br)cc1C(=O)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18BrClN2O/c1-3-8-20-11-13(17)9-15(20)16(21)19(2)10-12-4-6-14(18)7-5-12/h4-7,9,11H,3,8,10H2,1-2H3 |
| InChIKey | NAVXFQIBCAFNNY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.69 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |