C15H19BrN2OS — CID 79494376
4-bromo-N-methyl-1-propyl-N-(2-thiophen-2-ylethyl)pyrrole-2-carboxamide (PubChem CID 79494376) has the molecular formula C15H19BrN2OS and a molecular weight of 355.30 g/mol. Its IUPAC name is 4-bromo-N-methyl-1-propyl-N-(2-thiophen-2-ylethyl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-methyl-1-propyl-N-(2-thiophen-2-ylethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 79494376 |
| Molecular Formula | C15H19BrN2OS |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-bromo-N-methyl-1-propyl-N-(2-thiophen-2-ylethyl)pyrrole-2-carboxamide |
| SMILES | CCCn1cc(Br)cc1C(=O)N(C)CCc1cccs1 |
| InChI | InChI=1S/C15H19BrN2OS/c1-3-7-18-11-12(16)10-14(18)15(19)17(2)8-6-13-5-4-9-20-13/h4-5,9-11H,3,6-8H2,1-2H3 |
| InChIKey | HFXWECFWOBDSIA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |