C16H27BrN2O — CID 43641393
4-bromo-N,N-dibutyl-1-propylpyrrole-2-carboxamide (PubChem CID 43641393) has the molecular formula C16H27BrN2O and a molecular weight of 343.31 g/mol. Its IUPAC name is 4-bromo-N,N-dibutyl-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N,N-dibutyl-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43641393 |
| Molecular Formula | C16H27BrN2O |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-bromo-N,N-dibutyl-1-propylpyrrole-2-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1cc(Br)cn1CCC |
| InChI | InChI=1S/C16H27BrN2O/c1-4-7-10-18(11-8-5-2)16(20)15-12-14(17)13-19(15)9-6-3/h12-13H,4-11H2,1-3H3 |
| InChIKey | JMJHRYBNPTXVSC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |