C11H17BrN2O — CID 43640587
4-bromo-N,N,1-triethylpyrrole-2-carboxamide (PubChem CID 43640587) has the molecular formula C11H17BrN2O and a molecular weight of 273.17 g/mol. Its IUPAC name is 4-bromo-N,N,1-triethylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N,N,1-triethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43640587 |
| Molecular Formula | C11H17BrN2O |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 4-bromo-N,N,1-triethylpyrrole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(Br)cn1CC |
| InChI | InChI=1S/C11H17BrN2O/c1-4-13(5-2)11(15)10-7-9(12)8-14(10)6-3/h7-8H,4-6H2,1-3H3 |
| InChIKey | QPFFZGUITQCXME-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |