C11H11BrN4O — CID 43640915
4-bromo-N,N-bis(cyanomethyl)-1-ethylpyrrole-2-carboxamide (PubChem CID 43640915) has the molecular formula C11H11BrN4O and a molecular weight of 295.14 g/mol. Its IUPAC name is 4-bromo-N,N-bis(cyanomethyl)-1-ethylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N,N-bis(cyanomethyl)-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43640915 |
| Molecular Formula | C11H11BrN4O |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 4-bromo-N,N-bis(cyanomethyl)-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)N(CC#N)CC#N |
| InChI | InChI=1S/C11H11BrN4O/c1-2-15-8-9(12)7-10(15)11(17)16(5-3-13)6-4-14/h7-8H,2,5-6H2,1H3 |
| InChIKey | OQFUJAYBOVFCPV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|