C12H19BrN2O3 — CID 60955764
4-bromo-N,N-bis(2-hydroxyethyl)-1-propylpyrrole-2-carboxamide (PubChem CID 60955764) has the molecular formula C12H19BrN2O3 and a molecular weight of 319.20 g/mol. Its IUPAC name is 4-bromo-N,N-bis(2-hydroxyethyl)-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N,N-bis(2-hydroxyethyl)-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60955764 |
| Molecular Formula | C12H19BrN2O3 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 4-bromo-N,N-bis(2-hydroxyethyl)-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Br)cc1C(=O)N(CCO)CCO |
| InChI | InChI=1S/C12H19BrN2O3/c1-2-3-15-9-10(13)8-11(15)12(18)14(4-6-16)5-7-17/h8-9,16-17H,2-7H2,1H3 |
| InChIKey | NTYHCCPKJDWTFO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |