C12H18BrN3O2 — CID 43641605
4-bromo-N-methyl-N-[2-(methylamino)-2-oxoethyl]-1-propylpyrrole-2-carboxamide (PubChem CID 43641605) has the molecular formula C12H18BrN3O2 and a molecular weight of 316.20 g/mol. Its IUPAC name is 4-bromo-N-methyl-N-[2-(methylamino)-2-oxoethyl]-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-methyl-N-[2-(methylamino)-2-oxoethyl]-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43641605 |
| Molecular Formula | C12H18BrN3O2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-bromo-N-methyl-N-[2-(methylamino)-2-oxoethyl]-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Br)cc1C(=O)N(C)CC(=O)NC |
| InChI | InChI=1S/C12H18BrN3O2/c1-4-5-16-7-9(13)6-10(16)12(18)15(3)8-11(17)14-2/h6-7H,4-5,8H2,1-3H3,(H,14,17) |
| InChIKey | LLKBPVQDVXFDQH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |